C17H15N5 — CID 11460447
N-(4-ethylphenyl)-1H-imidazo[4,5-g]quinazolin-8-amine (PubChem CID 11460447) has the molecular formula C17H15N5 and a molecular weight of 289.34 g/mol. Its IUPAC name is N-(4-ethylphenyl)-1H-imidazo[4,5-g]quinazolin-8-amine.
| Compound Name | N-(4-ethylphenyl)-1H-imidazo[4,5-g]quinazolin-8-amine |
|---|---|
| PubChem CID | 11460447 |
| Molecular Formula | C17H15N5 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | N-(4-ethylphenyl)-1H-imidazo[4,5-g]quinazolin-8-amine |
| SMILES | CCc1ccc(Nc2ncnc3cc4nc[nH]c4cc23)cc1 |
| InChI | InChI=1S/C17H15N5/c1-2-11-3-5-12(6-4-11)22-17-13-7-15-16(20-9-19-15)8-14(13)18-10-21-17/h3-10H,2H2,1H3,(H,19,20)(H,18,21,22) |
| InChIKey | CYQMHOUJNOXLRG-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |