C10H14ClNO3 — CID 114605632
4-chloro-1-(1-methoxybutan-2-yl)pyrrole-2-carboxylic acid (PubChem CID 114605632) has the molecular formula C10H14ClNO3 and a molecular weight of 231.68 g/mol. Its IUPAC name is 4-chloro-1-(1-methoxybutan-2-yl)pyrrole-2-carboxylic acid.
| Compound Name | 4-chloro-1-(1-methoxybutan-2-yl)pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 114605632 |
| Molecular Formula | C10H14ClNO3 |
| Molecular Weight | 231.68 g/mol |
| Exact Mass | 231.07 |
| IUPAC Name | 4-chloro-1-(1-methoxybutan-2-yl)pyrrole-2-carboxylic acid |
| SMILES | CCC(COC)n1cc(Cl)cc1C(=O)O |
| InChI | InChI=1S/C10H14ClNO3/c1-3-8(6-15-2)12-5-7(11)4-9(12)10(13)14/h4-5,8H,3,6H2,1-2H3,(H,13,14) |
| InChIKey | ZNZRIBNYIQCVHB-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.68 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |