C10H15IN2O2 — CID 114606394
1-[1-(dimethylamino)propan-2-yl]-4-iodopyrrole-2-carboxylic acid (PubChem CID 114606394) has the molecular formula C10H15IN2O2 and a molecular weight of 322.15 g/mol. Its IUPAC name is 1-[1-(dimethylamino)propan-2-yl]-4-iodopyrrole-2-carboxylic acid.
| Compound Name | 1-[1-(dimethylamino)propan-2-yl]-4-iodopyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 114606394 |
| Molecular Formula | C10H15IN2O2 |
| Molecular Weight | 322.15 g/mol |
| Exact Mass | 322.02 |
| IUPAC Name | 1-[1-(dimethylamino)propan-2-yl]-4-iodopyrrole-2-carboxylic acid |
| SMILES | CC(CN(C)C)n1cc(I)cc1C(=O)O |
| InChI | InChI=1S/C10H15IN2O2/c1-7(5-12(2)3)13-6-8(11)4-9(13)10(14)15/h4,6-7H,5H2,1-3H3,(H,14,15) |
| InChIKey | HIEHNNDRJKOTBF-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 45.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.15 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|