C13H16Cl3NO3S — CID 114606832
methyl 1-(3-methylsulfanylbutyl)-4-(2,2,2-trichloroacetyl)pyrrole-2-carboxylate (PubChem CID 114606832) has the molecular formula C13H16Cl3NO3S and a molecular weight of 372.70 g/mol. Its IUPAC name is methyl 1-(3-methylsulfanylbutyl)-4-(2,2,2-trichloroacetyl)pyrrole-2-carboxylate.
| Compound Name | methyl 1-(3-methylsulfanylbutyl)-4-(2,2,2-trichloroacetyl)pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 114606832 |
| Molecular Formula | C13H16Cl3NO3S |
| Molecular Weight | 372.70 g/mol |
| Exact Mass | 370.99 |
| IUPAC Name | methyl 1-(3-methylsulfanylbutyl)-4-(2,2,2-trichloroacetyl)pyrrole-2-carboxylate |
| SMILES | COC(=O)c1cc(C(=O)C(Cl)(Cl)Cl)cn1CCC(C)SC |
| InChI | InChI=1S/C13H16Cl3NO3S/c1-8(21-3)4-5-17-7-9(11(18)13(14,15)16)6-10(17)12(19)20-2/h6-8H,4-5H2,1-3H3 |
| InChIKey | SGOCDNBXYYSWKZ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.70 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|