C13H14Cl3NO3 — CID 114604889
methyl 1-(2,2-dimethylcyclopropyl)-4-(2,2,2-trichloroacetyl)pyrrole-2-carboxylate (PubChem CID 114604889) has the molecular formula C13H14Cl3NO3 and a molecular weight of 338.62 g/mol. Its IUPAC name is methyl 1-(2,2-dimethylcyclopropyl)-4-(2,2,2-trichloroacetyl)pyrrole-2-carboxylate.
| Compound Name | methyl 1-(2,2-dimethylcyclopropyl)-4-(2,2,2-trichloroacetyl)pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 114604889 |
| Molecular Formula | C13H14Cl3NO3 |
| Molecular Weight | 338.62 g/mol |
| Exact Mass | 337.00 |
| IUPAC Name | methyl 1-(2,2-dimethylcyclopropyl)-4-(2,2,2-trichloroacetyl)pyrrole-2-carboxylate |
| SMILES | COC(=O)c1cc(C(=O)C(Cl)(Cl)Cl)cn1C1CC1(C)C |
| InChI | InChI=1S/C13H14Cl3NO3/c1-12(2)5-9(12)17-6-7(10(18)13(14,15)16)4-8(17)11(19)20-3/h4,6,9H,5H2,1-3H3 |
| InChIKey | HCNOXTRANNAVOD-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.62 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|