C14H18Cl3NO3 — CID 114604938
methyl 1-hexan-3-yl-4-(2,2,2-trichloroacetyl)pyrrole-2-carboxylate (PubChem CID 114604938) has the molecular formula C14H18Cl3NO3 and a molecular weight of 354.66 g/mol. Its IUPAC name is methyl 1-hexan-3-yl-4-(2,2,2-trichloroacetyl)pyrrole-2-carboxylate.
| Compound Name | methyl 1-hexan-3-yl-4-(2,2,2-trichloroacetyl)pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 114604938 |
| Molecular Formula | C14H18Cl3NO3 |
| Molecular Weight | 354.66 g/mol |
| Exact Mass | 353.04 |
| IUPAC Name | methyl 1-hexan-3-yl-4-(2,2,2-trichloroacetyl)pyrrole-2-carboxylate |
| SMILES | CCCC(CC)n1cc(C(=O)C(Cl)(Cl)Cl)cc1C(=O)OC |
| InChI | InChI=1S/C14H18Cl3NO3/c1-4-6-10(5-2)18-8-9(12(19)14(15,16)17)7-11(18)13(20)21-3/h7-8,10H,4-6H2,1-3H3 |
| InChIKey | FQKCYDZKQPKGIE-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.66 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|