C11H13Cl3IN3O — CID 89494042
2,2,2-trichloro-1-[1-[(2S)-1-diazenylpentan-2-yl]-4-iodopyrrol-2-yl]ethanone (PubChem CID 89494042) has the molecular formula C11H13Cl3IN3O and a molecular weight of 436.51 g/mol. Its IUPAC name is 2,2,2-trichloro-1-[1-[(2S)-1-diazenylpentan-2-yl]-4-iodopyrrol-2-yl]ethanone.
| Compound Name | 2,2,2-trichloro-1-[1-[(2S)-1-diazenylpentan-2-yl]-4-iodopyrrol-2-yl]ethanone |
|---|---|
| PubChem CID | 89494042 |
| Molecular Formula | C11H13Cl3IN3O |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 434.92 |
| IUPAC Name | 2,2,2-trichloro-1-[1-[(2S)-1-diazenylpentan-2-yl]-4-iodopyrrol-2-yl]ethanone |
| SMILES | [H]/N=N/C[C@H](CCC)n1cc(I)cc1C(=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C11H13Cl3IN3O/c1-2-3-8(5-17-16)18-6-7(15)4-9(18)10(19)11(12,13)14/h4,6,8,16H,2-3,5H2,1H3/b17-16+/t8-/m0/s1 |
| InChIKey | PZPWPWPVPHYKOW-ZQHZZJAZSA-N |
| XLogP | 5.02 |
| TPSA | 58.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|