About methyl 2-heptan-4-ylpyrazolo[3,4-b]pyridine-5-carboxylate
methyl 2-heptan-4-ylpyrazolo[3,4-b]pyridine-5-carboxylate (PubChem CID 175951880) has the molecular formula C15H21N3O2
and a molecular weight of 275.35 g/mol. Its IUPAC name is methyl 2-heptan-4-ylpyrazolo[3,4-b]pyridine-5-carboxylate.
Molecular Properties
| Compound Name | methyl 2-heptan-4-ylpyrazolo[3,4-b]pyridine-5-carboxylate |
| PubChem CID | 175951880 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | methyl 2-heptan-4-ylpyrazolo[3,4-b]pyridine-5-carboxylate |
| SMILES | CCCC(CCC)n1cc2cc(C(=O)OC)cnc2n1 |
| InChI | InChI=1S/C15H21N3O2/c1-4-6-13(7-5-2)18-10-12-8-11(15(19)20-3)9-16-14(12)17-18/h8-10,13H,4-7H2,1-3H3 |
| InChIKey | COBCDXGQSJVLJW-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2-heptan-4-ylpyrazolo[3,4-b]pyridine-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-heptan-4-ylpyrazolo[3,4-b]pyridine-5-carboxylate?
The IUPAC name of methyl 2-heptan-4-ylpyrazolo[3,4-b]pyridine-5-carboxylate (CID 175951880) is methyl 2-heptan-4-ylpyrazolo[3,4-b]pyridine-5-carboxylate.
What is the SMILES notation for methyl 2-heptan-4-ylpyrazolo[3,4-b]pyridine-5-carboxylate?
The canonical SMILES for methyl 2-heptan-4-ylpyrazolo[3,4-b]pyridine-5-carboxylate is CCCC(CCC)n1cc2cc(C(=O)OC)cnc2n1.
What is the InChIKey of methyl 2-heptan-4-ylpyrazolo[3,4-b]pyridine-5-carboxylate?
The InChIKey is COBCDXGQSJVLJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N3O2/c1-4-6-13(7-5-2)18-10-12-8-11(15(19)20-3)9-16-14(12)17-18/h8-10,13H,4-7H2,1-3H3.
What are the key properties of methyl 2-heptan-4-ylpyrazolo[3,4-b]pyridine-5-carboxylate?
methyl 2-heptan-4-ylpyrazolo[3,4-b]pyridine-5-carboxylate has a molecular weight of 275.35 g/mol, XLogP of 3.36, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-heptan-4-ylpyrazolo[3,4-b]pyridine-5-carboxylate is sourced from PubChem (CID 175951880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).