C19H19NO3 — CID 11461025
N-benzyl-1-[3,5-bis(ethenoxy)-4-methoxyphenyl]methanimine (PubChem CID 11461025) has the molecular formula C19H19NO3 and a molecular weight of 309.37 g/mol. Its IUPAC name is N-benzyl-1-[3,5-bis(ethenoxy)-4-methoxyphenyl]methanimine.
| Compound Name | N-benzyl-1-[3,5-bis(ethenoxy)-4-methoxyphenyl]methanimine |
|---|---|
| PubChem CID | 11461025 |
| Molecular Formula | C19H19NO3 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | N-benzyl-1-[3,5-bis(ethenoxy)-4-methoxyphenyl]methanimine |
| SMILES | C=COc1cc(/C=N/Cc2ccccc2)cc(OC=C)c1OC |
| InChI | InChI=1S/C19H19NO3/c1-4-22-17-11-16(12-18(23-5-2)19(17)21-3)14-20-13-15-9-7-6-8-10-15/h4-12,14H,1-2,13H2,3H3/b20-14+ |
| InChIKey | AOQNSMOHKRSAJA-XSFVSMFZSA-N |
| XLogP | 4.36 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|