About N-benzyl-1-(2-methoxy-3-methylphenyl)methanimine;dichlorozirconium
N-benzyl-1-(2-methoxy-3-methylphenyl)methanimine;dichlorozirconium (PubChem CID 59034627) has the molecular formula C16H17Cl2NOZr
and a molecular weight of 401.45 g/mol. Its IUPAC name is N-benzyl-1-(2-methoxy-3-methylphenyl)methanimine;dichlorozirconium.
Molecular Properties
| Compound Name | N-benzyl-1-(2-methoxy-3-methylphenyl)methanimine;dichlorozirconium |
| PubChem CID | 59034627 |
| Molecular Formula | C16H17Cl2NOZr |
| Molecular Weight | 401.45 g/mol |
| Exact Mass | 398.97 |
| IUPAC Name | N-benzyl-1-(2-methoxy-3-methylphenyl)methanimine;dichlorozirconium |
| SMILES | COc1c(C)cccc1/C=N/Cc1ccccc1.Cl[Zr]Cl |
| InChI | InChI=1S/C16H17NO.2ClH.Zr/c1-13-7-6-10-15(16(13)18-2)12-17-11-14-8-4-3-5-9-14;;;/h3-10,12H,11H2,1-2H3;2*1H;/q;;;+2/p-2/b17-12+;;; |
| InChIKey | YBIKAOHFWNQBRB-DPSBJRLESA-L |
| XLogP | 5.00 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.45 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-1-(2-methoxy-3-methylphenyl)methanimine;dichlorozirconium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-1-(2-methoxy-3-methylphenyl)methanimine;dichlorozirconium?
The IUPAC name of N-benzyl-1-(2-methoxy-3-methylphenyl)methanimine;dichlorozirconium (CID 59034627) is N-benzyl-1-(2-methoxy-3-methylphenyl)methanimine;dichlorozirconium.
What is the SMILES notation for N-benzyl-1-(2-methoxy-3-methylphenyl)methanimine;dichlorozirconium?
The canonical SMILES for N-benzyl-1-(2-methoxy-3-methylphenyl)methanimine;dichlorozirconium is COc1c(C)cccc1/C=N/Cc1ccccc1.Cl[Zr]Cl.
What is the InChIKey of N-benzyl-1-(2-methoxy-3-methylphenyl)methanimine;dichlorozirconium?
The InChIKey is YBIKAOHFWNQBRB-DPSBJRLESA-L. The full InChI is InChI=1S/C16H17NO.2ClH.Zr/c1-13-7-6-10-15(16(13)18-2)12-17-11-14-8-4-3-5-9-14;;;/h3-10,12H,11H2,1-2H3;2*1H;/q;;;+2/p-2/b17-12+;;;.
What are the key properties of N-benzyl-1-(2-methoxy-3-methylphenyl)methanimine;dichlorozirconium?
N-benzyl-1-(2-methoxy-3-methylphenyl)methanimine;dichlorozirconium has a molecular weight of 401.45 g/mol, XLogP of 5.00, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-1-(2-methoxy-3-methylphenyl)methanimine;dichlorozirconium is sourced from PubChem (CID 59034627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).