C25H25NO6 — CID 2742134
[4-(benzyliminomethyl)-2-methoxyphenyl] 3,4,5-trimethoxybenzoate (PubChem CID 2742134) has the molecular formula C25H25NO6 and a molecular weight of 435.48 g/mol. Its IUPAC name is [4-(benzyliminomethyl)-2-methoxyphenyl] 3,4,5-trimethoxybenzoate.
| Compound Name | [4-(benzyliminomethyl)-2-methoxyphenyl] 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 2742134 |
| Molecular Formula | C25H25NO6 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | [4-(benzyliminomethyl)-2-methoxyphenyl] 3,4,5-trimethoxybenzoate |
| SMILES | COc1cc(/C=N/Cc2ccccc2)ccc1OC(=O)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C25H25NO6/c1-28-21-12-18(16-26-15-17-8-6-5-7-9-17)10-11-20(21)32-25(27)19-13-22(29-2)24(31-4)23(14-19)30-3/h5-14,16H,15H2,1-4H3/b26-16+ |
| InChIKey | LSBSCLPSOBJSRV-WGOQTCKBSA-N |
| XLogP | 4.56 |
| TPSA | 75.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|