C8H12N4 — CID 114619402
3-N-(2-methylprop-2-enyl)pyridazine-3,6-diamine (PubChem CID 114619402) has the molecular formula C8H12N4 and a molecular weight of 164.21 g/mol. Its IUPAC name is 3-N-(2-methylprop-2-enyl)pyridazine-3,6-diamine.
| Compound Name | 3-N-(2-methylprop-2-enyl)pyridazine-3,6-diamine |
|---|---|
| PubChem CID | 114619402 |
| Molecular Formula | C8H12N4 |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.11 |
| IUPAC Name | 3-N-(2-methylprop-2-enyl)pyridazine-3,6-diamine |
| SMILES | C=C(C)CNc1ccc(N)nn1 |
| InChI | InChI=1S/C8H12N4/c1-6(2)5-10-8-4-3-7(9)11-12-8/h3-4H,1,5H2,2H3,(H2,9,11)(H,10,12) |
| InChIKey | AUCRZMYXGWIGDB-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|