C13H25NO2 — CID 114622285
4-(2,2,5,5-tetramethyloxolan-3-yl)oxan-4-amine (PubChem CID 114622285) has the molecular formula C13H25NO2 and a molecular weight of 227.35 g/mol. Its IUPAC name is 4-(2,2,5,5-tetramethyloxolan-3-yl)oxan-4-amine.
| Compound Name | 4-(2,2,5,5-tetramethyloxolan-3-yl)oxan-4-amine |
|---|---|
| PubChem CID | 114622285 |
| Molecular Formula | C13H25NO2 |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.19 |
| IUPAC Name | 4-(2,2,5,5-tetramethyloxolan-3-yl)oxan-4-amine |
| SMILES | CC1(C)CC(C2(N)CCOCC2)C(C)(C)O1 |
| InChI | InChI=1S/C13H25NO2/c1-11(2)9-10(12(3,4)16-11)13(14)5-7-15-8-6-13/h10H,5-9,14H2,1-4H3 |
| InChIKey | WOOWYFQKKWPDIK-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |