C13H24O3 — CID 114622182
2-methyl-3-(2,2,5,5-tetramethyloxolan-3-yl)oxolan-3-ol (PubChem CID 114622182) has the molecular formula C13H24O3 and a molecular weight of 228.33 g/mol. Its IUPAC name is 2-methyl-3-(2,2,5,5-tetramethyloxolan-3-yl)oxolan-3-ol.
| Compound Name | 2-methyl-3-(2,2,5,5-tetramethyloxolan-3-yl)oxolan-3-ol |
|---|---|
| PubChem CID | 114622182 |
| Molecular Formula | C13H24O3 |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | 2-methyl-3-(2,2,5,5-tetramethyloxolan-3-yl)oxolan-3-ol |
| SMILES | CC1OCCC1(O)C1CC(C)(C)OC1(C)C |
| InChI | InChI=1S/C13H24O3/c1-9-13(14,6-7-15-9)10-8-11(2,3)16-12(10,4)5/h9-10,14H,6-8H2,1-5H3 |
| InChIKey | LUDNZLSLWNJNTB-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |