C14H8Br2FNO2 — CID 114672108
2-(3,5-dibromo-2-pyridinyl)-6-fluoro-2,3-dihydrochromen-4-one (PubChem CID 114672108) has the molecular formula C14H8Br2FNO2 and a molecular weight of 401.03 g/mol. Its IUPAC name is 2-(3,5-dibromo-2-pyridinyl)-6-fluoro-2,3-dihydrochromen-4-one.
| Compound Name | 2-(3,5-dibromo-2-pyridinyl)-6-fluoro-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 114672108 |
| Molecular Formula | C14H8Br2FNO2 |
| Molecular Weight | 401.03 g/mol |
| Exact Mass | 398.89 |
| IUPAC Name | 2-(3,5-dibromo-2-pyridinyl)-6-fluoro-2,3-dihydrochromen-4-one |
| SMILES | O=C1CC(c2ncc(Br)cc2Br)Oc2ccc(F)cc21 |
| InChI | InChI=1S/C14H8Br2FNO2/c15-7-3-10(16)14(18-6-7)13-5-11(19)9-4-8(17)1-2-12(9)20-13/h1-4,6,13H,5H2 |
| InChIKey | GWHGUNJFHLVSEG-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.03 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |