C22H21BrINO4 — CID 11467238
(4S)-3-[(E,2R,3S)-4-bromo-3-hydroxy-2-(2-iodoethyl)-5-phenylpent-4-enoyl]-4-phenyl-1,3-oxazolidin-2-one (PubChem CID 11467238) has the molecular formula C22H21BrINO4 and a molecular weight of 570.22 g/mol. Its IUPAC name is (4S)-3-[(E,2R,3S)-4-bromo-3-hydroxy-2-(2-iodoethyl)-5-phenylpent-4-enoyl]-4-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-[(E,2R,3S)-4-bromo-3-hydroxy-2-(2-iodoethyl)-5-phenylpent-4-enoyl]-4-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11467238 |
| Molecular Formula | C22H21BrINO4 |
| Molecular Weight | 570.22 g/mol |
| Exact Mass | 568.97 |
| IUPAC Name | (4S)-3-[(E,2R,3S)-4-bromo-3-hydroxy-2-(2-iodoethyl)-5-phenylpent-4-enoyl]-4-phenyl-1,3-oxazolidin-2-one |
| SMILES | O=C1OC[C@H](c2ccccc2)N1C(=O)[C@H](CCI)[C@H](O)/C(Br)=C\c1ccccc1 |
| InChI | InChI=1S/C22H21BrINO4/c23-18(13-15-7-3-1-4-8-15)20(26)17(11-12-24)21(27)25-19(14-29-22(25)28)16-9-5-2-6-10-16/h1-10,13,17,19-20,26H,11-12,14H2/b18-13+/t17-,19-,20+/m1/s1 |
| InChIKey | FAFIFNXWOOYVQX-FGMBITAOSA-N |
| XLogP | 4.94 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.22 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|