C6H5BrF2N2O2 — CID 114676546
5-bromo-4-(2,2-difluoroethoxy)-1H-pyrimidin-6-one (PubChem CID 114676546) has the molecular formula C6H5BrF2N2O2 and a molecular weight of 255.02 g/mol. Its IUPAC name is 5-bromo-4-(2,2-difluoroethoxy)-1H-pyrimidin-6-one.
| Compound Name | 5-bromo-4-(2,2-difluoroethoxy)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 114676546 |
| Molecular Formula | C6H5BrF2N2O2 |
| Molecular Weight | 255.02 g/mol |
| Exact Mass | 253.95 |
| IUPAC Name | 5-bromo-4-(2,2-difluoroethoxy)-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]cnc(OCC(F)F)c1Br |
| InChI | InChI=1S/C6H5BrF2N2O2/c7-4-5(12)10-2-11-6(4)13-1-3(8)9/h2-3H,1H2,(H,10,11,12) |
| InChIKey | YHPUPQQUKYGKSR-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.02 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |