C13H18N4O2 — CID 114687245
2-(3,4-dimethoxyphenyl)-1-(3-methyltriazol-4-yl)ethanamine (PubChem CID 114687245) has the molecular formula C13H18N4O2 and a molecular weight of 262.31 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-1-(3-methyltriazol-4-yl)ethanamine.
| Compound Name | 2-(3,4-dimethoxyphenyl)-1-(3-methyltriazol-4-yl)ethanamine |
|---|---|
| PubChem CID | 114687245 |
| Molecular Formula | C13H18N4O2 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-1-(3-methyltriazol-4-yl)ethanamine |
| SMILES | COc1ccc(CC(N)c2cnnn2C)cc1OC |
| InChI | InChI=1S/C13H18N4O2/c1-17-11(8-15-16-17)10(14)6-9-4-5-12(18-2)13(7-9)19-3/h4-5,7-8,10H,6,14H2,1-3H3 |
| InChIKey | NJHVAVVGHBNYST-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |