C9H15Br2N3 — CID 114692675
2-(3,5-dibromopyrazol-1-yl)-N,N-diethylethanamine (PubChem CID 114692675) has the molecular formula C9H15Br2N3 and a molecular weight of 325.05 g/mol. Its IUPAC name is 2-(3,5-dibromopyrazol-1-yl)-N,N-diethylethanamine.
| Compound Name | 2-(3,5-dibromopyrazol-1-yl)-N,N-diethylethanamine |
|---|---|
| PubChem CID | 114692675 |
| Molecular Formula | C9H15Br2N3 |
| Molecular Weight | 325.05 g/mol |
| Exact Mass | 322.96 |
| IUPAC Name | 2-(3,5-dibromopyrazol-1-yl)-N,N-diethylethanamine |
| SMILES | CCN(CC)CCn1nc(Br)cc1Br |
| InChI | InChI=1S/C9H15Br2N3/c1-3-13(4-2)5-6-14-9(11)7-8(10)12-14/h7H,3-6H2,1-2H3 |
| InChIKey | ULOCWYFEPUZURJ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.05 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |