C8H10Br2N2 — CID 114692453
3,5-dibromo-1-(3-methylbut-3-enyl)pyrazole (PubChem CID 114692453) has the molecular formula C8H10Br2N2 and a molecular weight of 293.99 g/mol. Its IUPAC name is 3,5-dibromo-1-(3-methylbut-3-enyl)pyrazole.
| Compound Name | 3,5-dibromo-1-(3-methylbut-3-enyl)pyrazole |
|---|---|
| PubChem CID | 114692453 |
| Molecular Formula | C8H10Br2N2 |
| Molecular Weight | 293.99 g/mol |
| Exact Mass | 291.92 |
| IUPAC Name | 3,5-dibromo-1-(3-methylbut-3-enyl)pyrazole |
| SMILES | C=C(C)CCn1nc(Br)cc1Br |
| InChI | InChI=1S/C8H10Br2N2/c1-6(2)3-4-12-8(10)5-7(9)11-12/h5H,1,3-4H2,2H3 |
| InChIKey | DCFOXLBGOWWDNI-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.99 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|