C9H15N3 — CID 130736693
3,5-dimethyl-1-(3-methylbut-3-enyl)-1,2,4-triazole (PubChem CID 130736693) has the molecular formula C9H15N3 and a molecular weight of 165.24 g/mol. Its IUPAC name is 3,5-dimethyl-1-(3-methylbut-3-enyl)-1,2,4-triazole.
| Compound Name | 3,5-dimethyl-1-(3-methylbut-3-enyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 130736693 |
| Molecular Formula | C9H15N3 |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | 3,5-dimethyl-1-(3-methylbut-3-enyl)-1,2,4-triazole |
| SMILES | C=C(C)CCn1nc(C)nc1C |
| InChI | InChI=1S/C9H15N3/c1-7(2)5-6-12-9(4)10-8(3)11-12/h1,5-6H2,2-4H3 |
| InChIKey | YVYZFMDVIMHQAQ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|