C7H10Br2N2S — CID 114692732
3,5-dibromo-1-(2-ethylsulfanylethyl)pyrazole (PubChem CID 114692732) has the molecular formula C7H10Br2N2S and a molecular weight of 314.05 g/mol. Its IUPAC name is 3,5-dibromo-1-(2-ethylsulfanylethyl)pyrazole.
| Compound Name | 3,5-dibromo-1-(2-ethylsulfanylethyl)pyrazole |
|---|---|
| PubChem CID | 114692732 |
| Molecular Formula | C7H10Br2N2S |
| Molecular Weight | 314.05 g/mol |
| Exact Mass | 311.89 |
| IUPAC Name | 3,5-dibromo-1-(2-ethylsulfanylethyl)pyrazole |
| SMILES | CCSCCn1nc(Br)cc1Br |
| InChI | InChI=1S/C7H10Br2N2S/c1-2-12-4-3-11-7(9)5-6(8)10-11/h5H,2-4H2,1H3 |
| InChIKey | ADXLMOUVSBCIIJ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.05 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|