C8H12Br2N2O2 — CID 114692436
3,5-dibromo-1-[2-(2-methoxyethoxy)ethyl]pyrazole (PubChem CID 114692436) has the molecular formula C8H12Br2N2O2 and a molecular weight of 328.00 g/mol. Its IUPAC name is 3,5-dibromo-1-[2-(2-methoxyethoxy)ethyl]pyrazole.
| Compound Name | 3,5-dibromo-1-[2-(2-methoxyethoxy)ethyl]pyrazole |
|---|---|
| PubChem CID | 114692436 |
| Molecular Formula | C8H12Br2N2O2 |
| Molecular Weight | 328.00 g/mol |
| Exact Mass | 325.93 |
| IUPAC Name | 3,5-dibromo-1-[2-(2-methoxyethoxy)ethyl]pyrazole |
| SMILES | COCCOCCn1nc(Br)cc1Br |
| InChI | InChI=1S/C8H12Br2N2O2/c1-13-4-5-14-3-2-12-8(10)6-7(9)11-12/h6H,2-5H2,1H3 |
| InChIKey | OWHDKMGONVKRHE-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.00 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|