C10H8Br2ClN3 — CID 114692808
6,8-dibromo-2-chloro-N,N-dimethylquinazolin-4-amine (PubChem CID 114692808) has the molecular formula C10H8Br2ClN3 and a molecular weight of 365.46 g/mol. Its IUPAC name is 6,8-dibromo-2-chloro-N,N-dimethylquinazolin-4-amine.
| Compound Name | 6,8-dibromo-2-chloro-N,N-dimethylquinazolin-4-amine |
|---|---|
| PubChem CID | 114692808 |
| Molecular Formula | C10H8Br2ClN3 |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 362.88 |
| IUPAC Name | 6,8-dibromo-2-chloro-N,N-dimethylquinazolin-4-amine |
| SMILES | CN(C)c1nc(Cl)nc2c(Br)cc(Br)cc12 |
| InChI | InChI=1S/C10H8Br2ClN3/c1-16(2)9-6-3-5(11)4-7(12)8(6)14-10(13)15-9/h3-4H,1-2H3 |
| InChIKey | PDJKMANDPYLGCX-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |