C10H9BrClN3 — CID 114693492
8-bromo-2-chloro-N,N-dimethylquinazolin-4-amine (PubChem CID 114693492) has the molecular formula C10H9BrClN3 and a molecular weight of 286.56 g/mol. Its IUPAC name is 8-bromo-2-chloro-N,N-dimethylquinazolin-4-amine.
| Compound Name | 8-bromo-2-chloro-N,N-dimethylquinazolin-4-amine |
|---|---|
| PubChem CID | 114693492 |
| Molecular Formula | C10H9BrClN3 |
| Molecular Weight | 286.56 g/mol |
| Exact Mass | 284.97 |
| IUPAC Name | 8-bromo-2-chloro-N,N-dimethylquinazolin-4-amine |
| SMILES | CN(C)c1nc(Cl)nc2c(Br)cccc12 |
| InChI | InChI=1S/C10H9BrClN3/c1-15(2)9-6-4-3-5-7(11)8(6)13-10(12)14-9/h3-5H,1-2H3 |
| InChIKey | VGMWKAQXRURYST-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.56 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |