C12H16FN3O2S — CID 114694533
3-fluoro-4-(1,2,3,6-tetrahydropyridin-4-ylmethylamino)benzenesulfonamide (PubChem CID 114694533) has the molecular formula C12H16FN3O2S and a molecular weight of 285.34 g/mol. Its IUPAC name is 3-fluoro-4-(1,2,3,6-tetrahydropyridin-4-ylmethylamino)benzenesulfonamide.
| Compound Name | 3-fluoro-4-(1,2,3,6-tetrahydropyridin-4-ylmethylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 114694533 |
| Molecular Formula | C12H16FN3O2S |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | 3-fluoro-4-(1,2,3,6-tetrahydropyridin-4-ylmethylamino)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(NCC2=CCNCC2)c(F)c1 |
| InChI | InChI=1S/C12H16FN3O2S/c13-11-7-10(19(14,17)18)1-2-12(11)16-8-9-3-5-15-6-4-9/h1-3,7,15-16H,4-6,8H2,(H2,14,17,18) |
| InChIKey | XPCLYWXAZHNBOP-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|