C15H22N2O2 — CID 114694767
8-(1,2,3,6-tetrahydropyridin-4-ylmethyl)-8-azaspiro[4.5]decane-7,9-dione (PubChem CID 114694767) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is 8-(1,2,3,6-tetrahydropyridin-4-ylmethyl)-8-azaspiro[4.5]decane-7,9-dione.
| Compound Name | 8-(1,2,3,6-tetrahydropyridin-4-ylmethyl)-8-azaspiro[4.5]decane-7,9-dione |
|---|---|
| PubChem CID | 114694767 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 8-(1,2,3,6-tetrahydropyridin-4-ylmethyl)-8-azaspiro[4.5]decane-7,9-dione |
| SMILES | O=C1CC2(CCCC2)CC(=O)N1CC1=CCNCC1 |
| InChI | InChI=1S/C15H22N2O2/c18-13-9-15(5-1-2-6-15)10-14(19)17(13)11-12-3-7-16-8-4-12/h3,16H,1-2,4-11H2 |
| InChIKey | YQIAVRMDHQXREY-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|