C12H18O3 — CID 11469882
(6R)-5,7,9-trioxadispiro[5.1.58.26]pentadec-14-ene (PubChem CID 11469882) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is (6R)-5,7,9-trioxadispiro[5.1.58.26]pentadec-14-ene.
| Compound Name | (6R)-5,7,9-trioxadispiro[5.1.58.26]pentadec-14-ene |
|---|---|
| PubChem CID | 11469882 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | (6R)-5,7,9-trioxadispiro[5.1.58.26]pentadec-14-ene |
| SMILES | C1=C[C@@]2(CCCCO2)OC12CCCCO2 |
| InChI | InChI=1S/C12H18O3/c1-3-9-13-11(5-1)7-8-12(15-11)6-2-4-10-14-12/h7-8H,1-6,9-10H2/t11-,12?/m1/s1 |
| InChIKey | PNFPLRRUTHVLQI-JHJMLUEUSA-N |
| XLogP | 2.37 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_misc_A(5)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|