C15H20N2 — CID 11470216
(3aR,8bS)-3,4-dimethyl-8b-prop-2-enyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indole (PubChem CID 11470216) has the molecular formula C15H20N2 and a molecular weight of 228.34 g/mol. Its IUPAC name is (3aR,8bS)-3,4-dimethyl-8b-prop-2-enyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indole.
| Compound Name | (3aR,8bS)-3,4-dimethyl-8b-prop-2-enyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indole |
|---|---|
| PubChem CID | 11470216 |
| Molecular Formula | C15H20N2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | (3aR,8bS)-3,4-dimethyl-8b-prop-2-enyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indole |
| SMILES | C=CC[C@@]12CCN(C)[C@@H]1N(C)c1ccccc12 |
| InChI | InChI=1S/C15H20N2/c1-4-9-15-10-11-16(2)14(15)17(3)13-8-6-5-7-12(13)15/h4-8,14H,1,9-11H2,2-3H3/t14-,15+/m1/s1 |
| InChIKey | YYNVODAUICQSSD-CABCVRRESA-N |
| XLogP | 2.61 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|