C10H13N3O5 — CID 11470830
[(4aR,8S,8aS)-2,2-dimethyl-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3]dioxin-8-yl] N-diazocarbamate (PubChem CID 11470830) has the molecular formula C10H13N3O5 and a molecular weight of 255.23 g/mol. Its IUPAC name is [(4aR,8S,8aS)-2,2-dimethyl-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3]dioxin-8-yl] N-diazocarbamate.
| Compound Name | [(4aR,8S,8aS)-2,2-dimethyl-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3]dioxin-8-yl] N-diazocarbamate |
|---|---|
| PubChem CID | 11470830 |
| Molecular Formula | C10H13N3O5 |
| Molecular Weight | 255.23 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | [(4aR,8S,8aS)-2,2-dimethyl-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3]dioxin-8-yl] N-diazocarbamate |
| SMILES | CC1(C)OC[C@H]2OC=C[C@H](OC(=O)N=[N+]=[N-])[C@@H]2O1 |
| InChI | InChI=1S/C10H13N3O5/c1-10(2)16-5-7-8(18-10)6(3-4-15-7)17-9(14)12-13-11/h3-4,6-8H,5H2,1-2H3/t6-,7+,8-/m0/s1 |
| InChIKey | PJLDBGPKQCWMPO-RNJXMRFFSA-N |
| XLogP | 1.87 |
| TPSA | 102.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.23 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|