About 7-fluoro-2-methyl-2-pentyl-N-propyl-3,4-dihydrochromen-4-amine
7-fluoro-2-methyl-2-pentyl-N-propyl-3,4-dihydrochromen-4-amine (PubChem CID 114713953) has the molecular formula C18H28FNO
and a molecular weight of 293.43 g/mol. Its IUPAC name is 7-fluoro-2-methyl-2-pentyl-N-propyl-3,4-dihydrochromen-4-amine.
Molecular Properties
| Compound Name | 7-fluoro-2-methyl-2-pentyl-N-propyl-3,4-dihydrochromen-4-amine |
| PubChem CID | 114713953 |
| Molecular Formula | C18H28FNO |
| Molecular Weight | 293.43 g/mol |
| Exact Mass | 293.22 |
| IUPAC Name | 7-fluoro-2-methyl-2-pentyl-N-propyl-3,4-dihydrochromen-4-amine |
| SMILES | CCCCCC1(C)CC(NCCC)c2ccc(F)cc2O1 |
| InChI | InChI=1S/C18H28FNO/c1-4-6-7-10-18(3)13-16(20-11-5-2)15-9-8-14(19)12-17(15)21-18/h8-9,12,16,20H,4-7,10-11,13H2,1-3H3 |
| InChIKey | UNDHKQFAKXSQDE-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.43 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-fluoro-2-methyl-2-pentyl-N-propyl-3,4-dihydrochromen-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-2-methyl-2-pentyl-N-propyl-3,4-dihydrochromen-4-amine?
The IUPAC name of 7-fluoro-2-methyl-2-pentyl-N-propyl-3,4-dihydrochromen-4-amine (CID 114713953) is 7-fluoro-2-methyl-2-pentyl-N-propyl-3,4-dihydrochromen-4-amine.
What is the SMILES notation for 7-fluoro-2-methyl-2-pentyl-N-propyl-3,4-dihydrochromen-4-amine?
The canonical SMILES for 7-fluoro-2-methyl-2-pentyl-N-propyl-3,4-dihydrochromen-4-amine is CCCCCC1(C)CC(NCCC)c2ccc(F)cc2O1.
What is the InChIKey of 7-fluoro-2-methyl-2-pentyl-N-propyl-3,4-dihydrochromen-4-amine?
The InChIKey is UNDHKQFAKXSQDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28FNO/c1-4-6-7-10-18(3)13-16(20-11-5-2)15-9-8-14(19)12-17(15)21-18/h8-9,12,16,20H,4-7,10-11,13H2,1-3H3.
What are the key properties of 7-fluoro-2-methyl-2-pentyl-N-propyl-3,4-dihydrochromen-4-amine?
7-fluoro-2-methyl-2-pentyl-N-propyl-3,4-dihydrochromen-4-amine has a molecular weight of 293.43 g/mol, XLogP of 4.99, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-2-methyl-2-pentyl-N-propyl-3,4-dihydrochromen-4-amine is sourced from PubChem (CID 114713953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).