C18H30O2Si — CID 11472285
(2R)-1-[(3R)-6-methyl-3-propan-2-ylcyclohexa-1,5-dien-1-yl]-5-trimethylsilylpent-4-yne-1,2-diol (PubChem CID 11472285) has the molecular formula C18H30O2Si and a molecular weight of 306.52 g/mol. Its IUPAC name is (2R)-1-[(3R)-6-methyl-3-propan-2-ylcyclohexa-1,5-dien-1-yl]-5-trimethylsilylpent-4-yne-1,2-diol.
| Compound Name | (2R)-1-[(3R)-6-methyl-3-propan-2-ylcyclohexa-1,5-dien-1-yl]-5-trimethylsilylpent-4-yne-1,2-diol |
|---|---|
| PubChem CID | 11472285 |
| Molecular Formula | C18H30O2Si |
| Molecular Weight | 306.52 g/mol |
| Exact Mass | 306.20 |
| IUPAC Name | (2R)-1-[(3R)-6-methyl-3-propan-2-ylcyclohexa-1,5-dien-1-yl]-5-trimethylsilylpent-4-yne-1,2-diol |
| SMILES | CC1=CC[C@H](C(C)C)C=C1C(O)[C@H](O)CC#C[Si](C)(C)C |
| InChI | InChI=1S/C18H30O2Si/c1-13(2)15-10-9-14(3)16(12-15)18(20)17(19)8-7-11-21(4,5)6/h9,12-13,15,17-20H,8,10H2,1-6H3/t15-,17+,18?/m0/s1 |
| InChIKey | KTDRDGHINLWXMM-CTDRKSARSA-N |
| XLogP | 3.53 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.52 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|