C26H48O3Si2 — CID 101248714
(1R,2R)-5-trimethylsilyl-1-[(3S)-3-[(2S)-1-tri(propan-2-yl)silyloxypropan-2-yl]cyclohexa-1,5-dien-1-yl]pent-4-yne-1,2-diol (PubChem CID 101248714) has the molecular formula C26H48O3Si2 and a molecular weight of 464.84 g/mol. Its IUPAC name is (1R,2R)-5-trimethylsilyl-1-[(3S)-3-[(2S)-1-tri(propan-2-yl)silyloxypropan-2-yl]cyclohexa-1,5-dien-1-yl]pent-4-yne-1,2-diol.
| Compound Name | (1R,2R)-5-trimethylsilyl-1-[(3S)-3-[(2S)-1-tri(propan-2-yl)silyloxypropan-2-yl]cyclohexa-1,5-dien-1-yl]pent-4-yne-1,2-diol |
|---|---|
| PubChem CID | 101248714 |
| Molecular Formula | C26H48O3Si2 |
| Molecular Weight | 464.84 g/mol |
| Exact Mass | 464.31 |
| IUPAC Name | (1R,2R)-5-trimethylsilyl-1-[(3S)-3-[(2S)-1-tri(propan-2-yl)silyloxypropan-2-yl]cyclohexa-1,5-dien-1-yl]pent-4-yne-1,2-diol |
| SMILES | CC(C)[Si](OC[C@@H](C)[C@@H]1C=C([C@@H](O)[C@H](O)CC#C[Si](C)(C)C)C=CC1)(C(C)C)C(C)C |
| InChI | InChI=1S/C26H48O3Si2/c1-19(2)31(20(3)4,21(5)6)29-18-22(7)23-13-11-14-24(17-23)26(28)25(27)15-12-16-30(8,9)10/h11,14,17,19-23,25-28H,13,15,18H2,1-10H3/t22-,23+,25-,26-/m1/s1 |
| InChIKey | KRPRMLCXRZTGMD-PZXVYJQKSA-N |
| XLogP | 6.31 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.84 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|