C24H42O3Si — CID 134942753
(2R)-1-[(3S)-6-methyl-3-[(2S)-1-tri(propan-2-yl)silyloxypropan-2-yl]cyclohexa-1,5-dien-1-yl]pent-4-yne-1,2-diol (PubChem CID 134942753) has the molecular formula C24H42O3Si and a molecular weight of 406.68 g/mol. Its IUPAC name is (2R)-1-[(3S)-6-methyl-3-[(2S)-1-tri(propan-2-yl)silyloxypropan-2-yl]cyclohexa-1,5-dien-1-yl]pent-4-yne-1,2-diol.
| Compound Name | (2R)-1-[(3S)-6-methyl-3-[(2S)-1-tri(propan-2-yl)silyloxypropan-2-yl]cyclohexa-1,5-dien-1-yl]pent-4-yne-1,2-diol |
|---|---|
| PubChem CID | 134942753 |
| Molecular Formula | C24H42O3Si |
| Molecular Weight | 406.68 g/mol |
| Exact Mass | 406.29 |
| IUPAC Name | (2R)-1-[(3S)-6-methyl-3-[(2S)-1-tri(propan-2-yl)silyloxypropan-2-yl]cyclohexa-1,5-dien-1-yl]pent-4-yne-1,2-diol |
| SMILES | C#CC[C@@H](O)C(O)C1=C[C@@H]([C@H](C)CO[Si](C(C)C)(C(C)C)C(C)C)CC=C1C |
| InChI | InChI=1S/C24H42O3Si/c1-10-11-23(25)24(26)22-14-21(13-12-19(22)8)20(9)15-27-28(16(2)3,17(4)5)18(6)7/h1,12,14,16-18,20-21,23-26H,11,13,15H2,2-9H3/t20-,21+,23-,24?/m1/s1 |
| InChIKey | RUCHFMOJVVGDLC-URGFVATNSA-N |
| XLogP | 5.45 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.68 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|