C26H44O2Si — CID 10740655
(2E,7E)-9-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethyl-1-(2,6,6-trimethylcyclohex-2-en-1-yl)nona-2,7-dien-5-yn-4-ol (PubChem CID 10740655) has the molecular formula C26H44O2Si and a molecular weight of 416.72 g/mol. Its IUPAC name is (2E,7E)-9-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethyl-1-(2,6,6-trimethylcyclohex-2-en-1-yl)nona-2,7-dien-5-yn-4-ol.
| Compound Name | (2E,7E)-9-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethyl-1-(2,6,6-trimethylcyclohex-2-en-1-yl)nona-2,7-dien-5-yn-4-ol |
|---|---|
| PubChem CID | 10740655 |
| Molecular Formula | C26H44O2Si |
| Molecular Weight | 416.72 g/mol |
| Exact Mass | 416.31 |
| IUPAC Name | (2E,7E)-9-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethyl-1-(2,6,6-trimethylcyclohex-2-en-1-yl)nona-2,7-dien-5-yn-4-ol |
| SMILES | CC1=CCCC(C)(C)C1C/C=C(\C)C(O)C#C/C(C)=C/CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H44O2Si/c1-20(17-19-28-29(9,10)25(4,5)6)13-16-24(27)22(3)14-15-23-21(2)12-11-18-26(23,7)8/h12,14,17,23-24,27H,11,15,18-19H2,1-10H3/b20-17+,22-14+ |
| InChIKey | RNPAWRBWPGTGCM-UIIZNUQFSA-N |
| XLogP | 7.04 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.72 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|