C17H36O2Si — CID 134952069
(Z,4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2,4,6,6-tetramethylhept-2-en-1-ol (PubChem CID 134952069) has the molecular formula C17H36O2Si and a molecular weight of 300.56 g/mol. Its IUPAC name is (Z,4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2,4,6,6-tetramethylhept-2-en-1-ol.
| Compound Name | (Z,4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2,4,6,6-tetramethylhept-2-en-1-ol |
|---|---|
| PubChem CID | 134952069 |
| Molecular Formula | C17H36O2Si |
| Molecular Weight | 300.56 g/mol |
| Exact Mass | 300.25 |
| IUPAC Name | (Z,4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2,4,6,6-tetramethylhept-2-en-1-ol |
| SMILES | C/C(=C/[C@@H](C)[C@H](O[Si](C)(C)C(C)(C)C)C(C)(C)C)CO |
| InChI | InChI=1S/C17H36O2Si/c1-13(12-18)11-14(2)15(16(3,4)5)19-20(9,10)17(6,7)8/h11,14-15,18H,12H2,1-10H3/b13-11-/t14-,15+/m1/s1 |
| InChIKey | AKZYHRJGNWNFEQ-ZDZFUCEFSA-N |
| XLogP | 5.00 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.56 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|