C27H50O3Si2 — CID 11363603
(1S,2R)-1-[(3S)-6-methyl-3-[(2S)-1-tri(propan-2-yl)silyloxypropan-2-yl]cyclohexa-1,5-dien-1-yl]-5-trimethylsilylpent-4-yne-1,2-diol (PubChem CID 11363603) has the molecular formula C27H50O3Si2 and a molecular weight of 478.87 g/mol. Its IUPAC name is (1S,2R)-1-[(3S)-6-methyl-3-[(2S)-1-tri(propan-2-yl)silyloxypropan-2-yl]cyclohexa-1,5-dien-1-yl]-5-trimethylsilylpent-4-yne-1,2-diol.
| Compound Name | (1S,2R)-1-[(3S)-6-methyl-3-[(2S)-1-tri(propan-2-yl)silyloxypropan-2-yl]cyclohexa-1,5-dien-1-yl]-5-trimethylsilylpent-4-yne-1,2-diol |
|---|---|
| PubChem CID | 11363603 |
| Molecular Formula | C27H50O3Si2 |
| Molecular Weight | 478.87 g/mol |
| Exact Mass | 478.33 |
| IUPAC Name | (1S,2R)-1-[(3S)-6-methyl-3-[(2S)-1-tri(propan-2-yl)silyloxypropan-2-yl]cyclohexa-1,5-dien-1-yl]-5-trimethylsilylpent-4-yne-1,2-diol |
| SMILES | CC1=CC[C@H]([C@H](C)CO[Si](C(C)C)(C(C)C)C(C)C)C=C1[C@H](O)[C@H](O)CC#C[Si](C)(C)C |
| InChI | InChI=1S/C27H50O3Si2/c1-19(2)32(20(3)4,21(5)6)30-18-23(8)24-15-14-22(7)25(17-24)27(29)26(28)13-12-16-31(9,10)11/h14,17,19-21,23-24,26-29H,13,15,18H2,1-11H3/t23-,24+,26-,27+/m1/s1 |
| InChIKey | LLEXOEVTIZFLPF-PTJMHOJZSA-N |
| XLogP | 6.70 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.87 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|