C24H40O3Si2 — CID 11133822
(4Z)-4-[4-[tert-butyl(dimethyl)silyl]oxybut-2-ynylidene]-3-[3-[tert-butyl(dimethyl)silyl]oxyprop-1-ynyl]cyclopent-2-en-1-ol (PubChem CID 11133822) has the molecular formula C24H40O3Si2 and a molecular weight of 432.75 g/mol. Its IUPAC name is (4Z)-4-[4-[tert-butyl(dimethyl)silyl]oxybut-2-ynylidene]-3-[3-[tert-butyl(dimethyl)silyl]oxyprop-1-ynyl]cyclopent-2-en-1-ol.
| Compound Name | (4Z)-4-[4-[tert-butyl(dimethyl)silyl]oxybut-2-ynylidene]-3-[3-[tert-butyl(dimethyl)silyl]oxyprop-1-ynyl]cyclopent-2-en-1-ol |
|---|---|
| PubChem CID | 11133822 |
| Molecular Formula | C24H40O3Si2 |
| Molecular Weight | 432.75 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | (4Z)-4-[4-[tert-butyl(dimethyl)silyl]oxybut-2-ynylidene]-3-[3-[tert-butyl(dimethyl)silyl]oxyprop-1-ynyl]cyclopent-2-en-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)OCC#C/C=C1/CC(O)C=C1C#CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H40O3Si2/c1-23(2,3)28(7,8)26-16-12-11-14-20-18-22(25)19-21(20)15-13-17-27-29(9,10)24(4,5)6/h14,19,22,25H,16-18H2,1-10H3/b20-14- |
| InChIKey | AFWMSAPYYPYAAN-ZHZULCJRSA-N |
| XLogP | 5.65 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.75 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|