C21H40O3Si — CID 11291611
(Z,4R,5R,6R,7R,8S)-7-[tert-butyl(dimethyl)silyl]oxy-2-ethynyl-4,6,8-trimethyldec-2-ene-1,5-diol (PubChem CID 11291611) has the molecular formula C21H40O3Si and a molecular weight of 368.63 g/mol. Its IUPAC name is (Z,4R,5R,6R,7R,8S)-7-[tert-butyl(dimethyl)silyl]oxy-2-ethynyl-4,6,8-trimethyldec-2-ene-1,5-diol.
| Compound Name | (Z,4R,5R,6R,7R,8S)-7-[tert-butyl(dimethyl)silyl]oxy-2-ethynyl-4,6,8-trimethyldec-2-ene-1,5-diol |
|---|---|
| PubChem CID | 11291611 |
| Molecular Formula | C21H40O3Si |
| Molecular Weight | 368.63 g/mol |
| Exact Mass | 368.27 |
| IUPAC Name | (Z,4R,5R,6R,7R,8S)-7-[tert-butyl(dimethyl)silyl]oxy-2-ethynyl-4,6,8-trimethyldec-2-ene-1,5-diol |
| SMILES | C#C/C(=C/[C@@H](C)[C@@H](O)[C@@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)CC)CO |
| InChI | InChI=1S/C21H40O3Si/c1-11-15(3)20(24-25(9,10)21(6,7)8)17(5)19(23)16(4)13-18(12-2)14-22/h2,13,15-17,19-20,22-23H,11,14H2,1,3-10H3/b18-13-/t15-,16+,17+,19+,20+/m0/s1 |
| InChIKey | GTCFDYPRGYQRPC-PTWGJOGTSA-N |
| XLogP | 4.61 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.63 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|