C13H18O — CID 11472969
(3S)-4,4-dimethyl-3-[(3-methylcyclobuta-1,3-dien-1-yl)methoxy]cyclopentene (PubChem CID 11472969) has the molecular formula C13H18O and a molecular weight of 190.29 g/mol. Its IUPAC name is (3S)-4,4-dimethyl-3-[(3-methylcyclobuta-1,3-dien-1-yl)methoxy]cyclopentene.
| Compound Name | (3S)-4,4-dimethyl-3-[(3-methylcyclobuta-1,3-dien-1-yl)methoxy]cyclopentene |
|---|---|
| PubChem CID | 11472969 |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.14 |
| IUPAC Name | (3S)-4,4-dimethyl-3-[(3-methylcyclobuta-1,3-dien-1-yl)methoxy]cyclopentene |
| SMILES | CC1=CC(CO[C@H]2C=CCC2(C)C)=C1 |
| InChI | InChI=1S/C13H18O/c1-10-7-11(8-10)9-14-12-5-4-6-13(12,2)3/h4-5,7-8,12H,6,9H2,1-3H3/t12-/m0/s1 |
| InChIKey | HCDXCSJLCMYSKS-LBPRGKRZSA-N |
| XLogP | 3.24 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|