C16H24NO5P — CID 11473295
tert-butyl N-[(1R,2R,3R)-2-dimethoxyphosphoryl-3-phenylcyclopropyl]carbamate (PubChem CID 11473295) has the molecular formula C16H24NO5P and a molecular weight of 341.34 g/mol. Its IUPAC name is tert-butyl N-[(1R,2R,3R)-2-dimethoxyphosphoryl-3-phenylcyclopropyl]carbamate.
| Compound Name | tert-butyl N-[(1R,2R,3R)-2-dimethoxyphosphoryl-3-phenylcyclopropyl]carbamate |
|---|---|
| PubChem CID | 11473295 |
| Molecular Formula | C16H24NO5P |
| Molecular Weight | 341.34 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | tert-butyl N-[(1R,2R,3R)-2-dimethoxyphosphoryl-3-phenylcyclopropyl]carbamate |
| SMILES | COP(=O)(OC)[C@H]1[C@H](NC(=O)OC(C)(C)C)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C16H24NO5P/c1-16(2,3)22-15(18)17-13-12(11-9-7-6-8-10-11)14(13)23(19,20-4)21-5/h6-10,12-14H,1-5H3,(H,17,18)/t12-,13-,14-/m1/s1 |
| InChIKey | NKHSQOCBOLKLBT-MGPQQGTHSA-N |
| XLogP | 3.53 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.34 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|