C17H14ClN5O2S — CID 11474701
N'-(5-chloro-1H-indole-2-carbonyl)-1,3-dimethylthieno[3,2-d]pyrazole-5-carbohydrazide (PubChem CID 11474701) has the molecular formula C17H14ClN5O2S and a molecular weight of 387.85 g/mol. Its IUPAC name is N'-(5-chloro-1H-indole-2-carbonyl)-1,3-dimethylthieno[3,2-d]pyrazole-5-carbohydrazide.
| Compound Name | N'-(5-chloro-1H-indole-2-carbonyl)-1,3-dimethylthieno[3,2-d]pyrazole-5-carbohydrazide |
|---|---|
| PubChem CID | 11474701 |
| Molecular Formula | C17H14ClN5O2S |
| Molecular Weight | 387.85 g/mol |
| Exact Mass | 387.06 |
| IUPAC Name | N'-(5-chloro-1H-indole-2-carbonyl)-1,3-dimethylthieno[3,2-d]pyrazole-5-carbohydrazide |
| SMILES | Cc1nn(C)c2sc(C(=O)NNC(=O)c3cc4cc(Cl)ccc4[nH]3)cc12 |
| InChI | InChI=1S/C17H14ClN5O2S/c1-8-11-7-14(26-17(11)23(2)22-8)16(25)21-20-15(24)13-6-9-5-10(18)3-4-12(9)19-13/h3-7,19H,1-2H3,(H,20,24)(H,21,25) |
| InChIKey | SDOIWXXOUXZMOM-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 91.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.85 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|