C17H22O2 — CID 114747027
3-(3,4-dihydro-2H-chromen-8-yl)-5,5-dimethylcyclohex-2-en-1-ol (PubChem CID 114747027) has the molecular formula C17H22O2 and a molecular weight of 258.36 g/mol. Its IUPAC name is 3-(3,4-dihydro-2H-chromen-8-yl)-5,5-dimethylcyclohex-2-en-1-ol.
| Compound Name | 3-(3,4-dihydro-2H-chromen-8-yl)-5,5-dimethylcyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 114747027 |
| Molecular Formula | C17H22O2 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | 3-(3,4-dihydro-2H-chromen-8-yl)-5,5-dimethylcyclohex-2-en-1-ol |
| SMILES | CC1(C)CC(c2cccc3c2OCCC3)=CC(O)C1 |
| InChI | InChI=1S/C17H22O2/c1-17(2)10-13(9-14(18)11-17)15-7-3-5-12-6-4-8-19-16(12)15/h3,5,7,9,14,18H,4,6,8,10-11H2,1-2H3 |
| InChIKey | TWWWRCSYGMSDMS-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |