C15H20BrNO2S — CID 114751104
2-(4-bromo-2-methylphenyl)sulfanyl-N-[[1-(2-hydroxyethyl)cyclopropyl]methyl]acetamide (PubChem CID 114751104) has the molecular formula C15H20BrNO2S and a molecular weight of 358.30 g/mol. Its IUPAC name is 2-(4-bromo-2-methylphenyl)sulfanyl-N-[[1-(2-hydroxyethyl)cyclopropyl]methyl]acetamide.
| Compound Name | 2-(4-bromo-2-methylphenyl)sulfanyl-N-[[1-(2-hydroxyethyl)cyclopropyl]methyl]acetamide |
|---|---|
| PubChem CID | 114751104 |
| Molecular Formula | C15H20BrNO2S |
| Molecular Weight | 358.30 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | 2-(4-bromo-2-methylphenyl)sulfanyl-N-[[1-(2-hydroxyethyl)cyclopropyl]methyl]acetamide |
| SMILES | Cc1cc(Br)ccc1SCC(=O)NCC1(CCO)CC1 |
| InChI | InChI=1S/C15H20BrNO2S/c1-11-8-12(16)2-3-13(11)20-9-14(19)17-10-15(4-5-15)6-7-18/h2-3,8,18H,4-7,9-10H2,1H3,(H,17,19) |
| InChIKey | ZZVVTNLPDAQMMH-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.30 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |