C14H21BrN3OS+ — CID 9204782
2-(4-bromo-2-methylphenyl)sulfanyl-N-(4-methylpiperazin-4-ium-1-yl)acetamide (PubChem CID 9204782) has the molecular formula C14H21BrN3OS+ and a molecular weight of 359.31 g/mol. Its IUPAC name is 2-(4-bromo-2-methylphenyl)sulfanyl-N-(4-methylpiperazin-4-ium-1-yl)acetamide.
| Compound Name | 2-(4-bromo-2-methylphenyl)sulfanyl-N-(4-methylpiperazin-4-ium-1-yl)acetamide |
|---|---|
| PubChem CID | 9204782 |
| Molecular Formula | C14H21BrN3OS+ |
| Molecular Weight | 359.31 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | 2-(4-bromo-2-methylphenyl)sulfanyl-N-(4-methylpiperazin-4-ium-1-yl)acetamide |
| SMILES | Cc1cc(Br)ccc1SCC(=O)NN1CC[NH+](C)CC1 |
| InChI | InChI=1S/C14H20BrN3OS/c1-11-9-12(15)3-4-13(11)20-10-14(19)16-18-7-5-17(2)6-8-18/h3-4,9H,5-8,10H2,1-2H3,(H,16,19)/p+1 |
| InChIKey | QPJJOBOMBNBCPL-UHFFFAOYSA-O |
| XLogP | 0.71 |
| TPSA | 36.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.31 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |