C21H32O4S2 — CID 11475447
(4S,6S)-4-(1,3-dithian-2-ylmethyl)-6-[2-[(4-methoxyphenyl)methoxy]ethyl]-2,2-dimethyl-1,3-dioxane (PubChem CID 11475447) has the molecular formula C21H32O4S2 and a molecular weight of 412.62 g/mol. Its IUPAC name is (4S,6S)-4-(1,3-dithian-2-ylmethyl)-6-[2-[(4-methoxyphenyl)methoxy]ethyl]-2,2-dimethyl-1,3-dioxane.
| Compound Name | (4S,6S)-4-(1,3-dithian-2-ylmethyl)-6-[2-[(4-methoxyphenyl)methoxy]ethyl]-2,2-dimethyl-1,3-dioxane |
|---|---|
| PubChem CID | 11475447 |
| Molecular Formula | C21H32O4S2 |
| Molecular Weight | 412.62 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | (4S,6S)-4-(1,3-dithian-2-ylmethyl)-6-[2-[(4-methoxyphenyl)methoxy]ethyl]-2,2-dimethyl-1,3-dioxane |
| SMILES | COc1ccc(COCC[C@H]2C[C@@H](CC3SCCCS3)OC(C)(C)O2)cc1 |
| InChI | InChI=1S/C21H32O4S2/c1-21(2)24-18(13-19(25-21)14-20-26-11-4-12-27-20)9-10-23-15-16-5-7-17(22-3)8-6-16/h5-8,18-20H,4,9-15H2,1-3H3/t18-,19-/m0/s1 |
| InChIKey | XJUWBLUURJPISJ-OALUTQOASA-N |
| XLogP | 5.10 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.62 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|