C12H16N4O2 — CID 114764440
2-amino-3-[(2-propyl-1,2,4-triazol-3-yl)methoxy]phenol (PubChem CID 114764440) has the molecular formula C12H16N4O2 and a molecular weight of 248.29 g/mol. Its IUPAC name is 2-amino-3-[(2-propyl-1,2,4-triazol-3-yl)methoxy]phenol.
| Compound Name | 2-amino-3-[(2-propyl-1,2,4-triazol-3-yl)methoxy]phenol |
|---|---|
| PubChem CID | 114764440 |
| Molecular Formula | C12H16N4O2 |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 2-amino-3-[(2-propyl-1,2,4-triazol-3-yl)methoxy]phenol |
| SMILES | CCCn1ncnc1COc1cccc(O)c1N |
| InChI | InChI=1S/C12H16N4O2/c1-2-6-16-11(14-8-15-16)7-18-10-5-3-4-9(17)12(10)13/h3-5,8,17H,2,6-7,13H2,1H3 |
| InChIKey | RUSBNLCTLRWHIC-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 86.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|