C21H37NO8Si — CID 11476681
tert-butyl (3'aR,5S,7'S,7'aR)-7'-[tert-butyl(dimethyl)silyl]oxy-2',2'-dimethyl-2-oxospiro[1,3-oxazolidine-5,6'-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran]-3-carboxylate (PubChem CID 11476681) has the molecular formula C21H37NO8Si and a molecular weight of 459.61 g/mol. Its IUPAC name is tert-butyl (3'aR,5S,7'S,7'aR)-7'-[tert-butyl(dimethyl)silyl]oxy-2',2'-dimethyl-2-oxospiro[1,3-oxazolidine-5,6'-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran]-3-carboxylate.
| Compound Name | tert-butyl (3'aR,5S,7'S,7'aR)-7'-[tert-butyl(dimethyl)silyl]oxy-2',2'-dimethyl-2-oxospiro[1,3-oxazolidine-5,6'-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran]-3-carboxylate |
|---|---|
| PubChem CID | 11476681 |
| Molecular Formula | C21H37NO8Si |
| Molecular Weight | 459.61 g/mol |
| Exact Mass | 459.23 |
| IUPAC Name | tert-butyl (3'aR,5S,7'S,7'aR)-7'-[tert-butyl(dimethyl)silyl]oxy-2',2'-dimethyl-2-oxospiro[1,3-oxazolidine-5,6'-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran]-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@]2(OC[C@H]3OC(C)(C)O[C@H]3[C@@H]2O[Si](C)(C)C(C)(C)C)OC1=O |
| InChI | InChI=1S/C21H37NO8Si/c1-18(2,3)28-16(23)22-12-21(29-17(22)24)15(30-31(9,10)19(4,5)6)14-13(11-25-21)26-20(7,8)27-14/h13-15H,11-12H2,1-10H3/t13-,14-,15+,21+/m1/s1 |
| InChIKey | QQIYSGLZCKCKRX-MBIULKOWSA-N |
| XLogP | 4.01 |
| TPSA | 92.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.61 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|