C9H17N5O2 — CID 114778510
2-amino-N-[[1-(3-hydroxybutan-2-yl)triazol-4-yl]methyl]acetamide (PubChem CID 114778510) has the molecular formula C9H17N5O2 and a molecular weight of 227.27 g/mol. Its IUPAC name is 2-amino-N-[[1-(3-hydroxybutan-2-yl)triazol-4-yl]methyl]acetamide.
| Compound Name | 2-amino-N-[[1-(3-hydroxybutan-2-yl)triazol-4-yl]methyl]acetamide |
|---|---|
| PubChem CID | 114778510 |
| Molecular Formula | C9H17N5O2 |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 227.14 |
| IUPAC Name | 2-amino-N-[[1-(3-hydroxybutan-2-yl)triazol-4-yl]methyl]acetamide |
| SMILES | CC(O)C(C)n1cc(CNC(=O)CN)nn1 |
| InChI | InChI=1S/C9H17N5O2/c1-6(7(2)15)14-5-8(12-13-14)4-11-9(16)3-10/h5-7,15H,3-4,10H2,1-2H3,(H,11,16) |
| InChIKey | ZYUNBHSWIMGJKX-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 106.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |