C9H10O3 — CID 11480641
7-methyl-1,4-dioxaspiro[4.5]deca-6,9-dien-8-one (PubChem CID 11480641) has the molecular formula C9H10O3 and a molecular weight of 166.18 g/mol. Its IUPAC name is 7-methyl-1,4-dioxaspiro[4.5]deca-6,9-dien-8-one.
| Compound Name | 7-methyl-1,4-dioxaspiro[4.5]deca-6,9-dien-8-one |
|---|---|
| PubChem CID | 11480641 |
| Molecular Formula | C9H10O3 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.06 |
| IUPAC Name | 7-methyl-1,4-dioxaspiro[4.5]deca-6,9-dien-8-one |
| SMILES | CC1=CC2(C=CC1=O)OCCO2 |
| InChI | InChI=1S/C9H10O3/c1-7-6-9(3-2-8(7)10)11-4-5-12-9/h2-3,6H,4-5H2,1H3 |
| InChIKey | IGWHZUASSYNJKY-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |